CymitQuimica logo

CAS 120739-62-0

:

6-Chloro-N-methyl-3-pyridinemethanamine

Description:
6-Chloro-N-methyl-3-pyridinemethanamine, with the CAS number 120739-62-0, is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chlorine substituent at the 6-position of the pyridine ring and a methylamino group attached to the 3-position. The presence of the chlorine atom contributes to its reactivity and potential applications in various chemical reactions. As a tertiary amine, it exhibits basic properties and can participate in nucleophilic substitution reactions. The compound is of interest in medicinal chemistry and may have implications in the development of pharmaceuticals, particularly in the context of targeting specific biological pathways. Its solubility and stability in various solvents can vary, influencing its behavior in different chemical environments. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper precautions are taken.
Formula:C7H9ClN2
InChI:InChI=1S/C7H9ClN2/c1-9-4-6-2-3-7(8)10-5-6/h2-3,5,9H,4H2,1H3
InChI key:InChIKey=XALCOJXGWJXWBL-UHFFFAOYSA-N
SMILES:C(NC)C=1C=CC(Cl)=NC1
Synonyms:
  • 3-Pyridinemethanamine, 6-chloro-N-methyl-
  • 6-Chloro-N-methyl-3-pyridinemethanamine
  • 2-Chloro-5-(methylaminomethyl)pyridine
  • N-[(6-Chloropyridin-3-yl)methyl]methylamine
  • N-(6-Chloro-3-pyridylmethyl)-N-methylamine
Found 11 products.