CymitQuimica logo

CAS 1208077-23-9

:

1-Chloro-3,4-difluoro-2-methylbenzene

Description:
1-Chloro-3,4-difluoro-2-methylbenzene, also known as a chlorofluorobenzene derivative, is an aromatic compound characterized by the presence of a chlorine atom and two fluorine atoms on a benzene ring, along with a methyl group. This compound features a substituted benzene structure, which contributes to its chemical stability and reactivity. The chlorine and fluorine substituents influence its physical properties, such as boiling and melting points, making it more polar compared to unsubstituted benzene derivatives. The presence of these halogens can also enhance its reactivity in electrophilic aromatic substitution reactions. Additionally, the compound may exhibit unique solubility characteristics, often being soluble in organic solvents while having limited solubility in water. Its applications may extend to fields such as pharmaceuticals, agrochemicals, or materials science, where halogenated compounds are often utilized for their specific chemical properties. Safety considerations are important, as halogenated compounds can pose environmental and health risks, necessitating careful handling and disposal.
Formula:C7H5ClF2
InChI:InChI=1S/C7H5ClF2/c1-4-5(8)2-3-6(9)7(4)10/h2-3H,1H3
InChI key:InChIKey=XSXTVWMCENIWEP-UHFFFAOYSA-N
SMILES:CC1=C(F)C(F)=CC=C1Cl
Synonyms:
  • Benzene, 1-chloro-3,4-difluoro-2-methyl-
  • 1-Chloro-3,4-difluoro-2-methylbenzene
Found 3 products.