CymitQuimica logo

CAS 1208077-25-1

:

1-Bromo-2-chloro-5,6-difluorobenzene

Description:
1-Bromo-2-chloro-5,6-difluorobenzene is an aromatic halogenated compound characterized by the presence of bromine, chlorine, and fluorine substituents on a benzene ring. The molecular structure features a bromine atom at the first position, a chlorine atom at the second position, and two fluorine atoms at the fifth and sixth positions of the benzene ring. This substitution pattern contributes to its unique chemical properties, including increased reactivity and potential applications in organic synthesis and materials science. The presence of multiple halogens can enhance the compound's polarity and influence its solubility in various solvents. Additionally, the compound may exhibit interesting electronic properties due to the electron-withdrawing effects of the halogen substituents. As with many halogenated compounds, it is essential to handle 1-bromo-2-chloro-5,6-difluorobenzene with care, considering potential environmental and health impacts associated with halogenated organic compounds. Its specific applications may vary, but it is often explored in the context of pharmaceuticals, agrochemicals, and advanced materials.
Formula:C6H2BrClF2
InChI:InChI=1S/C6H2BrClF2/c7-5-3(8)1-2-4(9)6(5)10/h1-2H
InChI key:InChIKey=MWGRISBCIIDKSD-UHFFFAOYSA-N
SMILES:BrC1=C(F)C(F)=CC=C1Cl
Synonyms:
  • (6-Chloro-2,3-difluorophenyl)bromide
  • 2,3-Difluoro-6-chlorobromobenzene
  • 2-Bromo-1-chloro-3,4-difluorobenzene
  • Benzene, 2-bromo-1-chloro-3,4-difluoro-
  • 1-Bromo-2-chloro-5,6-difluorobenzene
Found 4 products.