CymitQuimica logo

CAS 1208315-24-5

:

N6022

Description:
The chemical substance identified by the name "N6022" and CAS number "1208315-24-5" is a specific compound that may not be widely recognized in general chemical literature. However, substances with such identifiers typically possess unique characteristics that can include specific molecular structure, reactivity, and applications. Generally, compounds are characterized by their physical properties such as melting point, boiling point, solubility, and density, as well as their chemical properties, including reactivity with other substances, stability under various conditions, and potential toxicity. Additionally, the compound may have specific uses in industrial applications, pharmaceuticals, or research. For precise information regarding N6022, including its safety data, handling procedures, and detailed chemical behavior, it is advisable to consult specialized databases, safety data sheets, or scientific literature that focus on this particular compound. Always ensure to handle chemical substances with appropriate safety measures and in compliance with regulatory guidelines.
Formula:C24H22N4O3
InChI:InChI=1S/C24H22N4O3/c1-16-14-18(24(25)31)4-9-21(16)28-20(8-11-23(29)30)7-10-22(28)17-2-5-19(6-3-17)27-13-12-26-15-27/h2-7,9-10,12-15H,8,11H2,1H3,(H2,25,31)(H,29,30)
InChI key:YVPGZQLRPAGKLA-UHFFFAOYSA-N
SMILES:CC1=C(C=CC(=C1)C(=O)N)N2C(=CC=C2C3=CC=C(C=C3)N4C=CN=C4)CCC(=O)O
Found 6 products.