CymitQuimica logo

CAS 120944-75-4

:

BOC-PEN(MOB)-OH

Description:
BOC-PEN(MOB)-OH, with the CAS number 120944-75-4, is a chemical compound that serves as a protected form of the amino acid penicillin. It features a tert-butyloxycarbonyl (BOC) protecting group, which is commonly used in organic synthesis to protect amine functionalities during chemical reactions. The compound also contains a methoxybenzyl (MOB) group, which enhances its stability and solubility. BOC-PEN(MOB)-OH is typically utilized in peptide synthesis and pharmaceutical research, particularly in the development of peptide-based drugs. Its structure allows for selective reactions, facilitating the introduction of other functional groups while maintaining the integrity of the penicillin core. The compound is generally characterized by its solid state at room temperature, and it is soluble in organic solvents such as dichloromethane and methanol. As with many chemical substances, proper handling and storage conditions are essential to maintain its stability and prevent degradation.
Formula:C18H27NO5S
InChI:InChI=1/C18H27NO5S/c1-17(2,3)24-16(22)19-14(15(20)21)18(4,5)25-11-12-7-9-13(23-6)10-8-12/h7-10,14H,11H2,1-6H3,(H,19,22)(H,20,21)/t14-/m1/s1
InChI key:NEUHEEDQLRFEIM-CQSZACIVSA-N
SMILES:CC(C)(C)OC(=N[C@H](C(=O)O)C(C)(C)SCc1ccc(cc1)OC)O
Found 5 products.