CAS 1210-83-9: N-acetyl-5-hydroxytryptamine
Description:N-acetyl-5-hydroxytryptamine, commonly known as melatonin, is a naturally occurring indoleamine that plays a crucial role in regulating circadian rhythms and sleep-wake cycles in various organisms. It is synthesized from the amino acid tryptophan and is primarily produced in the pineal gland of the brain. This compound is characterized by its ability to act as an antioxidant and its involvement in the modulation of various physiological processes, including sleep induction, immune response, and seasonal reproductive functions. Melatonin exhibits lipophilic properties, allowing it to cross cell membranes easily, and it binds to specific melatonin receptors in the body, influencing various signaling pathways. Its production is influenced by light exposure, with levels typically rising in the evening and falling in the morning, thus aligning with the natural light-dark cycle. Melatonin is also available as a dietary supplement, often used to alleviate sleep disorders and jet lag, although its efficacy and safety for long-term use are subjects of ongoing research.
Formula:C12H14N2O2
InChI:InChI=1/C12H14N2O2/c1-8(15)13-5-4-9-7-14-12-3-2-10(16)6-11(9)12/h2-3,6-7,14,16H,4-5H2,1H3,(H,13,15)
InChI key:InChIKey=MVAWJSIDNICKHF-UHFFFAOYSA-N
SMILES:O=C(NCCC1=CNC=2C=CC(O)=CC21)C