CAS 121123-33-9: 3,6-di-O-(A-D-mannopyranosyl)-D-*mannopyranose
Description:3,6-di-O-(α-D-mannopyranosyl)-D-mannopyranose is a disaccharide derivative characterized by the presence of two α-D-mannopyranosyl groups attached to a D-mannopyranose backbone. This compound features glycosidic linkages at the 3 and 6 positions, which influence its solubility, reactivity, and biological properties. The presence of multiple hydroxyl groups contributes to its hydrophilicity, making it soluble in water and potentially involved in various biochemical interactions. This compound may exhibit specific biological activities, including potential prebiotic effects or roles in cell signaling, due to its structural similarity to naturally occurring oligosaccharides. Its molecular structure allows for hydrogen bonding, which can affect its stability and interactions with other biomolecules. As a carbohydrate derivative, it may also be of interest in the fields of glycoscience and medicinal chemistry, particularly in the development of carbohydrate-based therapeutics or as a model for studying carbohydrate-protein interactions.
Formula:C18H32O16
InChI:InChI=1/C18H32O16/c19-1-4-7(21)10(24)12(26)17(32-4)30-3-6-9(23)15(14(28)16(29)31-6)34-18-13(27)11(25)8(22)5(2-20)33-18/h4-29H,1-3H2
- Synonyms:
- 3,6-Di-O-(a-D-mannopyranosyl)-d-mannopyrannose
- Hexopyranosyl-(1->3)-[Hexopyranosyl-(1->6)]Hexopyranose

Ref: 7W-GC1997
Undefined size | To inquire |

1,3-α-1,6-α-D-Mannotriose
Ref: 3D-OM05762
10mg | 398.00 € | ||
25mg | 562.00 € | ||
50mg | 990.00 € | ||
100mg | 1,716.00 € | ||
250mg | 4,139.00 € |

3,6-Di-O-(α-D-mannopyranosyl)-D-mannopyrannose
Controlled ProductRef: TR-D460650
1mg | 99.00 € | ||
10mg | 256.00 € |