CAS 1211441-98-3: LEE 011
Description:LEE 011, with the CAS number 1211441-98-3, is a chemical compound that functions primarily as a selective inhibitor of cyclin-dependent kinase 4 and 6 (CDK4/6). This inhibition plays a crucial role in regulating the cell cycle, particularly in the transition from the G1 phase to the S phase, thereby impacting cellular proliferation. LEE 011 is often studied in the context of cancer therapy, as it has shown potential in treating various types of tumors, especially those that are hormone receptor-positive. The compound is characterized by its ability to induce cell cycle arrest in cancer cells, leading to reduced tumor growth. Additionally, it is typically administered in a pharmaceutical formulation, and its efficacy and safety profile are evaluated through clinical trials. As with many targeted therapies, understanding its mechanism of action and potential side effects is essential for optimizing its use in clinical settings.
Formula:C23H30N8O
InChI:InChI=1S/C23H30N8O/c1-29(2)22(32)19-13-16-14-26-23(28-21(16)31(19)17-5-3-4-6-17)27-20-8-7-18(15-25-20)30-11-9-24-10-12-30/h7-8,13-15,17,24H,3-6,9-12H2,1-2H3,(H,25,26,27,28)
InChI key:InChIKey=RHXHGRAEPCAFML-UHFFFAOYSA-N
SMILES:O=C(C1=CC=2C=NC(=NC2N1C3CCCC3)NC4=NC=C(C=C4)N5CCNCC5)N(C)C
- Synonyms:
- 7-Cyclopentyl-N,N-dimethyl-2-[[5-(1-piperazinyl)-2-pyridinyl]amino]-7H-pyrrolo[2,3-d]pyrimidine-6-carboxamide
- 7H-Pyrrolo[2,3-d]pyrimidine-6-carboxamide, 7-cyclopentyl-N,N-dimethyl-2-[[5-(1-piperazinyl)-2-pyridinyl]amino]-
- Lee 011A
- Ribociclib
![7-Cyclopentyl-N,N-dimethyl-2-[[5-(1-piperazinyl)-2-pyridinyl]amino]-7H-pyrrolo[2,3-d]pyrimidine-6-…](https://static.cymitquimica.com/products/IN/thumb/DA003AC4.jpg)
![7-Cyclopentyl-N,N-Dimethyl-2-((5-(Piperazin-1-Yl)Pyridin-2-Yl)Amino)-7H-Pyrrolo[2,3-D]Pyrimidine-6…](https://static.cymitquimica.com/products/54/thumb/OR1026670.jpg)
