CymitQuimica logo

CAS 1211542-29-8

:

3-BROMO-5-FLUORO-2-METHYLPYRIDINE

Description:
3-Bromo-5-fluoro-2-methylpyridine is a heterocyclic organic compound characterized by a pyridine ring substituted with a bromine atom at the 3-position, a fluorine atom at the 5-position, and a methyl group at the 2-position. This compound belongs to the class of halogenated pyridines, which are known for their diverse applications in pharmaceuticals, agrochemicals, and materials science. The presence of both bromine and fluorine introduces significant polarity and reactivity, making it useful in various chemical reactions, including nucleophilic substitutions and coupling reactions. The methyl group contributes to the compound's hydrophobic character, influencing its solubility and interaction with biological systems. Additionally, the unique combination of halogen substituents can enhance the compound's biological activity, making it a candidate for further research in medicinal chemistry. Overall, 3-bromo-5-fluoro-2-methylpyridine exhibits properties typical of halogenated aromatic compounds, including potential applications in synthesis and as intermediates in organic reactions.
Formula:C6H5BrFN
InChI:InChI=1S/C6H5BrFN/c1-4-6(7)2-5(8)3-9-4/h2-3H,1H3
InChI key:FDUMMEFEKHPQBG-UHFFFAOYSA-N
SMILES:CC1=C(C=C(C=N1)F)Br
Found 4 products.