CAS 121204-87-3
:(ala,1,3,11,15)-endothelin-1
Description:
Endothelin-1, specifically the (ala,1,3,11,15)-form, is a potent vasoconstrictor peptide that plays a crucial role in regulating vascular tone and blood pressure. It is composed of 21 amino acids and is produced primarily by endothelial cells. This peptide is known for its ability to bind to endothelin receptors, particularly ETA and ETB, which are involved in various physiological processes, including smooth muscle contraction and cell proliferation. The (ala,1,3,11,15)-modification indicates specific substitutions at certain positions in the peptide sequence, which can influence its biological activity and receptor affinity. Endothelin-1 is implicated in various pathophysiological conditions, such as hypertension, heart failure, and pulmonary arterial hypertension. Its synthesis is stimulated by various factors, including hypoxia and inflammation, making it a significant target for therapeutic interventions. Overall, endothelin-1 is a key player in cardiovascular physiology and pathology, with ongoing research aimed at understanding its mechanisms and potential as a therapeutic target.
Formula:C109H163N25O32S
InChI:InChI=1/C109H163N25O32S/c1-16-56(9)86(113)104(159)134-88(57(10)17-2)106(161)129-78(43-64-47-115-69-28-22-21-27-67(64)69)108(163)166-109(164)79(46-84(141)142)128-97(152)72(39-53(3)4)124-99(154)75(44-65-48-114-52-116-65)122-90(145)59(12)118-96(151)73(41-62-25-19-18-20-26-62)125-98(153)74(42-63-30-32-66(138)33-31-63)126-105(160)87(55(7)8)133-92(147)61(14)117-94(149)71(121-95(150)70(29-23-24-37-110)120-100(155)76(45-83(139)140)123-93(148)68(112)36-38-167-15)34-35-85(143)165-107(162)77(40-54(5)6)127-102(157)82(51-137)132-103(158)81(50-136)131-91(146)60(13)119-101(156)80(49-135)130-89(144)58(11)111/h18-22,25-28,30-33,47-48,52-61,65,68,70-82,86-88,115,135-138H,16-17,23-24,29,34-46,49-51,110-113H2,1-15H3,(H,117,149)(H,118,151)(H,119,156)(H,120,155)(H,121,150)(H,122,145)(H,123,148)(H,124,154)(H,125,153)(H,126,160)(H,127,157)(H,128,152)(H,129,161)(H,130,144)(H,131,146)(H,132,158)(H,133,147)(H,134,159)(H,139,140)(H,141,142)/t56-,57-,58-,59-,60-,61-,65?,68-,70-,71-,72-,73-,74-,75-,76-,77-,78-,79-,80-,81-,82-,86-,87-,88-/m0/s1
SMILES:CC[C@H](C)[C@@H](C(=N[C@@H]([C@@H](C)CC)C(=N[C@@H](Cc1c[nH]c2ccccc12)C(=O)OC(=O)[C@H](CC(=O)O)N=C([C@H](CC(C)C)N=C([C@H](CC1C=NC=N1)N=C([C@H](C)N=C([C@H](Cc1ccccc1)N=C([C@H](Cc1ccc(cc1)O)N=C([C@H](C(C)C)N=C([C@H](C)N=C([C@H](CCC(=O)OC(=O)[C@H](CC(C)C)N=C([C@H](CO)N=C([C@H](CO)N=C([C@H](C)N=C([C@H](CO)N=C([C@H](C)N)O)O)O)O)O)N=C([C@H](CCCCN)N=C([C@H](CC(=O)O)N=C([C@H](CCSC)N)O)O)O)O)O)O)O)O)O)O)O)O)O)N
Synonyms:- (Ala131115)-Endothelin-1
- H-Ala-Ser-Ala-Ser-Ser-Leu-Met-Asp-Lys-Glu-Ala-Val-Tyr-Phe-Ala-His-Leu-Asp-Ile-Ile-Trp-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(Ala¹·³·¹¹·¹⁵)-Endothelin-1
CAS:4 Ala ET-1, linear analog of ET-1 is a selective agonist for ET-B receptors.Formula:C109H163N25O32SPurity:95.5%Color and Shape:White PowderMolecular weight:2367.71[Ala1,3,11,15]-Endothelin 1
CAS:Formula:C109H163N25O32SPurity:≥ 95.0%Color and Shape:White solidMolecular weight:2367.67[Ala1,3,11,15]-Endothelin
CAS:<p>Selective ETB endothelin receptor agonist (IC50 values are 0.33 and 2200 nM for displacing [125I]-ET-1 from ETB and ETA receptors respectively).</p>Formula:C109H163N25O32SPurity:98%Color and Shape:SolidMolecular weight:2368(Ala1·3·11·15)-Endothelin-1 trifluoroacetate salt
CAS:<p>(Ala1·3·11·15)-Endothelin-1 trifluoroacetate salt H-Ala-Ser-Ala-Ser-Ser-Leu-Met-Asp-Lys-Glu-Ala-Val-Tyr-Phe-Ala-His-Leu) is a phorbol ester, which is an analog of endothelin. It has been shown to inhibit the production of proinflammatory cytokines and chemokines in vitro and in vivo. This compound also inhibits the migration and proliferation of vascular endothelial cells, which may be due to its ability to suppress Ca2+ concentration. (Ala1·3·11·15)-Endothelin -1 trifluoroacetate salt H-) can also be used as a fluorescent marker for immunohistochemical studies on tissues such as vessels and gastrointestinal tissues. The localization of this drug can be observed by microscopy techniques such as</p>Formula:C109H163N25O32SPurity:Min. 95%Molecular weight:2,367.68 g/mol



