CymitQuimica logo

CAS 121238-27-5

:

2,3,4,6-Tetra-O-acetyl-a-D-mannopyranosyltrichloroacetimidate

Description:
2,3,4,6-Tetra-O-acetyl-α-D-mannopyranosyltrichloroacetimidate is a glycosyl donor commonly used in carbohydrate chemistry for the synthesis of glycosidic bonds. This compound features a D-mannopyranose unit that is fully acetylated at the hydroxyl groups, which enhances its stability and reactivity during glycosylation reactions. The presence of the trichloroacetimidate group serves as an excellent leaving group, facilitating the formation of glycosidic linkages with various acceptors. This compound is typically a white to off-white solid and is soluble in organic solvents such as dichloromethane and acetonitrile. Its reactivity can be influenced by the reaction conditions, including the choice of catalyst and solvent. Due to its structural characteristics, it is particularly valuable in the synthesis of complex carbohydrates and glycoconjugates, contributing to advancements in glycoscience and medicinal chemistry. Proper handling and storage are essential, as with many chemical substances, to ensure safety and maintain its integrity for research applications.
Formula:C16H20Cl3NO10
InChI:InChI=1S/C16H20Cl3NO10/c1-6(21)25-5-10-11(26-7(2)22)12(27-8(3)23)13(28-9(4)24)14(29-10)30-15(20)16(17,18)19/h10-14,20H,5H2,1-4H3/t10-,11-,12+,13+,14-/m1/s1
InChI key:IBUZGVQIKARDAF-PEBLQZBPSA-N
SMILES:CC(=O)OC[C@@H]1[C@H]([C@@H]([C@@H]([C@H](O1)OC(=N)C(Cl)(Cl)Cl)OC(=O)C)OC(=O)C)OC(=O)C
Found 6 products.