CAS 121288-39-9: Loxoribine
Description:Loxoribine is a synthetic nucleoside analog that exhibits immunomodulatory properties, primarily functioning as an agonist of Toll-like receptor 7 (TLR7). This compound is characterized by its ability to stimulate the immune response, making it of interest in the context of antiviral and anticancer therapies. Loxoribine is typically administered in a pharmaceutical form and is known for its potential to enhance the activity of immune cells, such as macrophages and dendritic cells. The chemical structure of Loxoribine includes a ribose sugar moiety, which is essential for its biological activity, and it is often studied for its effects on cytokine production and T-cell activation. Its CAS number, 121288-39-9, is a unique identifier that facilitates the tracking and study of this compound in scientific literature and databases. Overall, Loxoribine represents a significant area of research in immunotherapy, with ongoing studies exploring its efficacy and mechanisms of action in various disease models.
Formula:C13H17N5O6
InChI:InChI=1S/C13H17N5O6/c1-2-3-17-6-9(15-12(14)16-10(6)22)18(13(17)23)11-8(21)7(20)5(4-19)24-11/h2,5,7-8,11,19-21H,1,3-4H2,(H3,14,15,16,22)/t5-,7-,8-,11-/m1/s1
InChI key:InChIKey=VDCRFBBZFHHYGT-IOSLPCCCSA-N
SMILES:O=C1N=C(N)NC2=C1N(C(=O)N2C3OC(CO)C(O)C3O)CC=C
- Synonyms:
- 7,8-Dihydro-8-oxo-7-(2-propen-1-yl)guanosine
- 7-Allyl-2-amino-9-beta-D-ribofuranosylpurine-6,8(1H,9H)-dione
- 7-Allyl-8-oxoguanosine
- 8-Oxo-7-Prop-2-En-1-Ylguanosine
- Guanosine, 7,8-dihydro-8-oxo-7-(2-propen-1-yl)-
- Guanosine, 7,8-dihydro-8-oxo-7-(2-propenyl)-
- Loxoribina
- Loxoribina [INN-Spanish]
- Loxoribine [USAN:INN]
- Loxoribinum
- See more synonyms
- Loxoribinum [INN-Latin]
- Rwj 21757
- Unii-9Cas0V66Oi
- Loxoribine
