CAS 121368-52-3
:Olean-12-en-28-oicacid, 3-(b-D-glucopyranosyloxy)-2,16,23-trihydroxy-,(2b,3b,4a,16a)-
Description:
Olean-12-en-28-oic acid, 3-(β-D-glucopyranosyloxy)-2,16,23-trihydroxy-, (2β,3β,4α,16α)-, commonly referred to as a triterpenoid saponin, is a complex organic compound characterized by its oleanolic acid backbone, which features multiple hydroxyl groups and a glycosyl moiety. This structure contributes to its solubility and biological activity. The presence of the glucopyranosyl group enhances its hydrophilicity, making it more soluble in water compared to its aglycone counterpart. The compound exhibits various pharmacological properties, including anti-inflammatory, antioxidant, and potential anticancer activities, which are attributed to its ability to modulate cellular signaling pathways. Additionally, its trihydroxy functional groups play a crucial role in its reactivity and interaction with biological systems. The compound is of interest in medicinal chemistry and natural product research, particularly for its potential therapeutic applications. As with many saponins, it may also exhibit surfactant properties, influencing its behavior in biological membranes.
Formula:C36H58O11
InChI:InChI=1S/C36H58O11/c1-31(2)11-12-36(30(44)45)19(13-31)18-7-8-23-32(3)14-20(39)28(47-29-27(43)26(42)25(41)21(16-37)46-29)33(4,17-38)22(32)9-10-34(23,5)35(18,6)15-24(36)40/h7,19-29,37-43H,8-17H2,1-6H3,(H,44,45)/t19-,20-,21+,22+,23+,24+,25+,26-,27+,28-,29-,32-,33-,34+,35+,36+/m0/s1
InChI key:XFVGJHHHDVZQFB-FWVVSBQTSA-N
SMILES:C[C@@]12CC[C@@H]3[C@@]([C@H]1CC=C4[C@]2(C[C@H]([C@@]5([C@H]4CC(CC5)(C)C)C(=O)O)O)C)(C[C@@H]([C@@H]([C@@]3(C)CO)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O)C
Synonyms:- BernardiosideA
- Polygalacic acid 3-O-b-D-glucopyranoside
- Bernardioside A
- 3-O-beta-D-Glucopyranosyl polygalacic acid
- Olean-12-en-28-oic acid, 3-(β-D-glucopyranosyloxy)-2,16,23-trihydroxy-, (2β,3β,4α,16α)-
- Polygalacic acid 3-O-beta-D-glucopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
Bernardioside A
CAS:Bernardioside A is a triterpenoid saponin isolated from Bellis bernardii that serves as a tool in phytochemistry and basic drug development research.Formula:C36H58O11Purity:98%Color and Shape:SolidMolecular weight:666.84Bernardioside A
CAS:Bernardioside A is a glycosidic compound, which is a naturally occurring product derived from plant sources. This compound is primarily isolated from specific plant species endemic to certain regions, where it is synthesized as part of the plant's secondary metabolites. The mode of action of Bernardioside A involves the modulation of inflammatory pathways, where it targets specific cellular receptors and signaling molecules to inhibit inflammation processes. It functions by suppressing the production of pro-inflammatory cytokines and mediators, effectively preventing the exacerbation of inflammation in biological systems.
Formula:C36H58O11Purity:Min. 95%Molecular weight:666.85 g/mol






