CAS 121377-67-1

ENDOTHELIN (16-21)

Description:

Endothelin (16-21), also known as ET-1(16-21), is a peptide fragment derived from the larger endothelin-1 protein, which plays a crucial role in various physiological processes, including vasoconstriction and blood pressure regulation. This specific fragment consists of a sequence of amino acids that contributes to the biological activity of the endothelin family. The CAS number 121377-67-1 identifies this particular peptide, which is known for its potent vasoconstrictive properties. Endothelin peptides are primarily produced by endothelial cells and have been implicated in various cardiovascular diseases, making them significant in both research and therapeutic contexts. The characteristics of Endothelin (16-21) include its ability to bind to endothelin receptors, influencing smooth muscle contraction and cellular signaling pathways. Additionally, it is often studied for its role in pathophysiological conditions such as hypertension and heart failure. Understanding the properties and functions of this peptide is essential for developing targeted treatments for related cardiovascular disorders.

Formula: C₃₉H₅₇N₉O₉

InChI: InChI=1/C39H57N9O9/c1-7-21(5)32(37(54)46-30(39(56)57)14-23-17-42-27-12-10-9-11-25(23)27)48-38(55)33(22(6)8-2)47-36(53)29(16-31(49)50)45-35(52)28(13-20(3)4)44-34(51)26(40)15-24-18-41-19-43-24/h9-12,17-22,26,28-30,32-33,42H,7-8,13-16,40H2,1-6H3,(H,41,43)(H,44,51)(H,45,52)(H,46,54)(H,47,53)(H,48,55)(H,49,50)(H,56,57)/t21-,22-,26-,28-,29-,30-,32-,33-/m0/s1

SMILES: CC[C@H](C)[C@@H](C(=N[C@@H](Cc1c[nH]c2ccccc12)C(=O)O)O)N=C([C@H]([C@@H](C)CC)N=C([C@H](CC(=O)O)N=C([C@H](CC(C)C)N=C([C@H](Cc1cnc[nH]1)N)O)O)O)O

Synonyms:

• Endothelin C-Terminal Hexapeptide
• H-His-Leu-Asp-Ile-Ile-Trp-Oh
• L-histidyl-L-leucyl-L-alpha-aspartyl-L-isoleucyl-L-isoleucyl-L-tryptophan

Endothelin (16-21) trifluoroacetate salt

CAS: 121377-67-1

Endothelin (ET) is a potent vasoactive peptide that is produced by endothelial cells in response to injury or inflammation. ET binds to the endothelin receptors and activates phospholipase A2, which releases arachidonic acid from membrane phospholipids. This leads to the production of prostaglandins and thromboxanes, which increase vascular permeability and induce vasoconstriction. Endothelin also causes smooth muscle contraction and relaxation in many tissues including the mesenteric, skeletal, and cardiac muscles. The binding of ET to its receptor increases blood pressure by causing vasoconstriction. ET is used as a tool for studying receptor binding in guinea pigs because it has been shown that it has biphasic effects on tracheal contractility at low doses (i.e., it causes relaxation) but at high doses (i.e., it causes constriction).

Formula: C₃₉H₅₇N₉O₉

Purity: Min. 95%

Molecular weight: 795.93 g/mol

Ref: 3D-FE109609