CymitQuimica logo

CAS 1215-98-1

:

1-[4-(4-AMINO-PHENOXY)-PHENYL]-ETHANONE

Description:
1-[4-(4-Amino-phenoxy)-phenyl]-ethanone, also known by its CAS number 1215-98-1, is an organic compound characterized by its aromatic structure and functional groups. It features a ketone group (ethanone) attached to a phenyl ring that is further substituted with a phenoxy group and an amino group. This compound typically exhibits properties associated with both aromatic amines and ketones, such as potential reactivity in electrophilic substitution reactions and the ability to participate in hydrogen bonding due to the amino group. It may also display moderate solubility in organic solvents, depending on the specific conditions and the presence of substituents. The amino group can impart basicity, while the ketone can influence the compound's reactivity and stability. Such compounds are often of interest in medicinal chemistry and materials science due to their potential biological activity and utility in synthesizing more complex molecules. Safety and handling precautions should be observed, as with many organic compounds, due to potential toxicity or reactivity.
Formula:C14H13NO2
InChI:InChI=1S/C14H13NO2/c1-10(16)11-2-6-13(7-3-11)17-14-8-4-12(15)5-9-14/h2-9H,15H2,1H3
InChI key:LLPBSWDPJYOIRK-UHFFFAOYSA-N
SMILES:CC(=O)C1=CC=C(C=C1)OC2=CC=C(C=C2)N
Found 2 products.