CymitQuimica logo

CAS 121554-18-5

:

(4'-Pentyl[1,1'-biphenyl]-4-yl)-boronic acid

Description:
(4'-Pentyl[1,1'-biphenyl]-4-yl)-boronic acid, with the CAS number 121554-18-5, is an organic compound characterized by the presence of a boronic acid functional group attached to a biphenyl structure. This compound features a pentyl substituent at the para position of one of the phenyl rings, which contributes to its hydrophobic properties and influences its solubility in organic solvents. Boronic acids are known for their ability to form reversible complexes with diols, making them valuable in organic synthesis and materials science, particularly in the development of sensors and drug delivery systems. The presence of the biphenyl moiety can enhance the compound's electronic properties, potentially making it useful in organic electronics and photonic applications. Additionally, the compound may exhibit interesting thermal and chemical stability, which can be advantageous in various applications. Overall, (4'-Pentyl[1,1'-biphenyl]-4-yl)-boronic acid is a versatile compound with potential applications in organic synthesis and materials science.
Formula:C17H21BO2
InChI:InChI=1S/C17H21BO2/c1-2-3-4-5-14-6-8-15(9-7-14)16-10-12-17(13-11-16)18(19)20/h6-13,19-20H,2-5H2,1H3
InChI key:QRZCEXCQSFQDMG-UHFFFAOYSA-N
SMILES:CCCCCc1ccc(cc1)c1ccc(cc1)B(O)O
Synonyms:
  • (4'-Pentyl[1,1'-biphenyl]-4-yl)boronic acid
Found 5 products.