CymitQuimica logo

CAS 1217002-90-8

:

5-bromo-1H,2H,3H-pyrrolo[2,3-c]pyridin-2-one

Description:
5-Bromo-1H,2H,3H-pyrrolo[2,3-c]pyridin-2-one is a heterocyclic organic compound characterized by its fused pyrrole and pyridine rings, which contribute to its unique chemical properties. The presence of a bromine atom at the 5-position enhances its reactivity and can influence its biological activity. This compound typically exhibits a solid-state at room temperature and is soluble in polar organic solvents, reflecting its polar functional groups. It may participate in various chemical reactions, including nucleophilic substitutions and electrophilic aromatic substitutions, due to the electron-withdrawing nature of the bromine atom. The compound's structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as many derivatives of pyrrolopyridines have shown biological activity. Additionally, its unique framework may allow for the exploration of new synthetic pathways and the design of novel materials. As with many brominated compounds, safety precautions should be taken due to potential toxicity and environmental concerns associated with bromine-containing substances.
Formula:C7H5BrN2O
InChI:InChI=1S/C7H5BrN2O/c8-6-1-4-2-7(11)10-5(4)3-9-6/h1,3H,2H2,(H,10,11)
InChI key:ITTBVIMPQOKVJZ-UHFFFAOYSA-N
SMILES:C1C2=CC(=NC=C2NC1=O)Br
Found 4 products.