CymitQuimica logo

CAS 1217272-21-3

:

1-(3-Pyridazinyl)-4-piperidinol

Description:
1-(3-Pyridazinyl)-4-piperidinol is a chemical compound characterized by its unique structural features, which include a pyridazine ring and a piperidin-4-ol moiety. The presence of the pyridazine ring contributes to its potential biological activity, as heterocyclic compounds often exhibit diverse pharmacological properties. The piperidin-4-ol part of the molecule introduces a secondary amine and a hydroxyl group, which can participate in hydrogen bonding and influence the compound's solubility and reactivity. This compound may be of interest in medicinal chemistry, particularly for its potential applications in drug development, as modifications to the piperidine or pyridazine components can lead to variations in activity and selectivity. Additionally, the compound's molecular weight, polarity, and functional groups play crucial roles in determining its behavior in biological systems and its interactions with other molecules. As with many organic compounds, understanding its synthesis, stability, and reactivity is essential for exploring its practical applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C9H13N3O
InChI:InChI=1S/C9H13N3O/c13-8-3-6-12(7-4-8)9-2-1-5-10-11-9/h1-2,5,8,13H,3-4,6-7H2
InChI key:InChIKey=RCRQICJWNOGCOC-UHFFFAOYSA-N
SMILES:OC1CCN(CC1)C2=CC=CN=N2
Synonyms:
  • 1-(3-Pyridazinyl)-4-piperidinol
  • 4-Piperidinol, 1-(3-pyridazinyl)-
Found 5 products.