CymitQuimica logo

CAS 1217710-80-9

:

3-[[(tert-Butoxy)carbonyl]amino]-1-piperidinecarboxylic acid tert-butyl ester

Description:
3-[[(tert-Butoxy)carbonyl]amino]-1-piperidinecarboxylic acid tert-butyl ester, with the CAS number 1217710-80-9, is a chemical compound characterized by its complex structure that includes a piperidine ring, a carboxylic acid functional group, and tert-butoxycarbonyl (Boc) protecting groups. This compound typically appears as a white to off-white solid and is soluble in organic solvents such as dichloromethane and methanol, but may have limited solubility in water. The presence of the tert-butyl ester and Boc groups indicates that it is likely used in organic synthesis, particularly in the preparation of amino acids or peptide derivatives. Its structure suggests potential applications in medicinal chemistry, where modifications to amino acids can lead to the development of bioactive compounds. The compound's stability and reactivity can be influenced by the protecting groups, making it a versatile intermediate in synthetic pathways. Safety data should be consulted for handling, as with all chemical substances, to ensure proper precautions are taken.
Formula:C15H28N2O4
InChI:InChI=1S/C15H28N2O4/c1-14(2,3)20-12(18)16-11-8-7-9-17(10-11)13(19)21-15(4,5)6/h11H,7-10H2,1-6H3,(H,16,18)
InChI key:IPDHHWCHJZHKMH-NSHDSACASA-N
SMILES:CC(C)(C)OC(=NC1CCCN(C1)C(=O)OC(C)(C)C)O
Found 2 products.