CymitQuimica logo

CAS 1217728-72-7

:

(S)-1-N-Boc-2-Methoxymethylpiperazine

Description:
(S)-1-N-Boc-2-Methoxymethylpiperazine is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. The "N-Boc" designation indicates the presence of a tert-butyloxycarbonyl (Boc) protecting group on one of the nitrogen atoms, which is commonly used in organic synthesis to protect amines. The methoxymethyl group at the 2-position adds a methoxy and a methyl group, enhancing the compound's solubility and reactivity. This compound is typically utilized in pharmaceutical chemistry and medicinal chemistry for the synthesis of various bioactive molecules, particularly in the development of potential drug candidates. Its chirality, indicated by the "(S)" prefix, suggests that it exists as one of two enantiomers, which can exhibit different biological activities. Overall, (S)-1-N-Boc-2-Methoxymethylpiperazine is valued for its versatility in synthetic applications and its role in the design of compounds with specific pharmacological properties.
Formula:C11H22N2O3
InChI:InChI=1S/C11H22N2O3/c1-11(2,3)16-10(14)13-6-5-12-7-9(13)8-15-4/h9,12H,5-8H2,1-4H3/t9-/m0/s1
InChI key:ODOJNXXZXCRBCC-VIFPVBQESA-N
SMILES:CC(C)(C)OC(=O)N1CCNC[C@H]1COC
Found 5 products.