CymitQuimica logo

CAS 1217858-20-2

:

(R)-tert-Butyl (pyrrolidin-3-ylmethyl)carbamate hydrochloride

Description:
(R)-tert-Butyl (pyrrolidin-3-ylmethyl)carbamate hydrochloride is a chemical compound characterized by its chiral structure, which includes a tert-butyl group and a pyrrolidine moiety. This compound is typically used in pharmaceutical applications, particularly in the synthesis of biologically active molecules. The presence of the carbamate functional group suggests potential reactivity and stability, making it suitable for various chemical transformations. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, enhancing its utility in biological systems. The compound's chirality indicates that it may exhibit specific interactions with biological targets, which is crucial in drug design and development. Its molecular properties, such as melting point, solubility, and stability, are influenced by the presence of the tert-butyl and pyrrolidine groups, which can affect its pharmacokinetic and pharmacodynamic profiles. Overall, this compound represents a valuable scaffold in medicinal chemistry, with potential applications in developing therapeutics.
Formula:C10H12ClN2O2
InChI:InChI=1S/C10H20N2O2.ClH/c1-10(2,3)14-9(13)12-7-8-4-5-11-6-8;/h8,11H,4-7H2,1-3H3,(H,12,13);1H/t8-;/m1./s1
InChI key:WEUDEPABMRKFFT-DDWIOCJRSA-N
SMILES:CC(C)(C)OC(=O)NC[C@@H]1CCNC1.Cl
Synonyms:
  • tert-butyl N-[[(3R)-pyrrolidin-3-yl]methyl]carbamate,hydrochloride
  • (R)-Pyrrolidin-3-Ylmethyl-Carbamic Acid Tert-Butyl Ester Hydrochloride
Found 4 products.