CAS 1218-69-5
:2-(2-Hydroxyphenyl)-4H-1,3-benzoxazin-4-one
Description:
2-(2-Hydroxyphenyl)-4H-1,3-benzoxazin-4-one, also known by its CAS number 1218-69-5, is a chemical compound characterized by its unique structure that includes a benzoxazine ring fused with a phenolic group. This compound typically exhibits properties such as being a solid at room temperature and having a relatively high melting point. It is known for its potential applications in various fields, including organic synthesis and materials science, due to its ability to act as a dye or a fluorescent marker. The presence of the hydroxyl group contributes to its reactivity and solubility in polar solvents. Additionally, this compound may exhibit biological activity, making it of interest in medicinal chemistry. Its stability under standard conditions and the ability to undergo various chemical reactions, such as oxidation or substitution, further enhance its utility in research and industrial applications. Overall, 2-(2-Hydroxyphenyl)-4H-1,3-benzoxazin-4-one is a versatile compound with significant potential in both scientific and practical applications.
Formula:C14H9NO3
InChI:InChI=1/C14H9NO3/c16-11-7-3-1-5-9(11)14-15-13(17)10-6-2-4-8-12(10)18-14/h1-8,16H
SMILES:c1ccc(c(c1)c1nc(=O)c2ccccc2o1)O
Synonyms:- 4H-1,3-benzoxazin-4-one, 2-(2-hydroxyphenyl)-
- 2-(2-Hydroxyphenyl)-4H-benzo[e][1,3]oxazin-4-one
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 12 products.
2-(2-Hydroxyphenyl)-4H-1,3-benzoxazin-4-one
CAS:Formula:C14H9NO3Purity:>98.0%(GC)Color and Shape:White to Orange to Green powder to crystalMolecular weight:239.232-(2-Hydroxyphenyl)-4H-benzo[E][1,3]oxazin-4-one
CAS:2-(2-Hydroxyphenyl)-4H-benzo[E][1,3]oxazin-4-oneFormula:C14H9NO3Purity:98%Molecular weight:239.226164H-1,3-Benzoxazin-4-one, 2-(2-hydroxyphenyl)-
CAS:Formula:C14H9NO3Purity:95%Color and Shape:SolidMolecular weight:239.2262Deferasirox EP Impurity B
CAS:Formula:C14H9NO3Color and Shape:Pale Yellow SolidMolecular weight:239.232-(2-Hydroxyphenyl)-4H-1,3-benzoxazin-4-one-d4 (Mixture of 2-Hydroxyphenyl-d4 & Benzoxazinone-d4)
CAS:Controlled ProductApplications Intermediate in the production of labelled Deferasirox.
Formula:C14D4H5NO3Color and Shape:NeatMolecular weight:486.5022-(2-Hydroxyphenyl)-4H-benzo[e][1,3]oxazin-4-one
CAS:2-(2-Hydroxyphenyl)-4H-benzo[e][1,3]oxazin-4-oneFormula:C14H9NO3Purity:98%Molecular weight:239.232-(2-Hydroxyphenyl)-4H-1,3-benzoxazin-4-one
CAS:Controlled ProductApplications Intermediate in the production of Deferasirox.
Formula:C14H9NO3Color and Shape:NeatMolecular weight:239.232-(2-Hydroxyphenyl)-4H-1,3-benzoxazin-4-one
CAS:2-(2-Hydroxyphenyl)-4H-1,3-benzoxazin-4-one is a carboxylate that can be found in many plants. It has been shown to have an inhibitory effect on the growth of fungi and bacteria. 2-(2-Hydroxyphenyl)-4H-1,3-benzoxazin-4-one can also be used as a ligand for metal ions. The carboxylate group interacts with the metal ion by donating a proton to it or by forming a coordinate covalent bond. This interaction stabilizes the metal ion and prevents its oxidation. The 2-(2-hydroxyphenyl)-4H-1,3-benzoxazin-4-one skeleton contains two cyclic tautomers that are interconvertible via protonation and deprotonation reactions. The tetrazole ring is able to undergo tautomerFormula:C14H9NO3Purity:Min. 95%Molecular weight:239.23 g/mol










