CymitQuimica logo

CAS 1218789-73-1

:

4,4,5,5-Tetramethyl-2-(3-methyl-5-propoxyphenyl)-1,3,2-dioxaborolane

Description:
4,4,5,5-Tetramethyl-2-(3-methyl-5-propoxyphenyl)-1,3,2-dioxaborolane is an organoboron compound characterized by its dioxaborolane structure, which features a boron atom bonded to two oxygen atoms and a carbon framework. This compound typically exhibits a stable, cyclic structure that is useful in various chemical applications, particularly in organic synthesis and materials science. The presence of multiple methyl groups enhances its hydrophobic properties, while the propoxy and phenyl substituents contribute to its potential reactivity and solubility in organic solvents. The compound may serve as a reagent in cross-coupling reactions, making it valuable in the synthesis of complex organic molecules. Additionally, its unique structure may impart specific optical or electronic properties, which could be exploited in the development of advanced materials or pharmaceuticals. As with many organoboron compounds, it is essential to handle this substance with care, considering its potential reactivity and the need for appropriate safety measures in laboratory settings.
Formula:C16H25BO3
InChI:InChI=1S/C16H25BO3/c1-7-8-18-14-10-12(2)9-13(11-14)17-19-15(3,4)16(5,6)20-17/h9-11H,7-8H2,1-6H3
InChI key:InChIKey=GNMZRYSYAHSLRP-UHFFFAOYSA-N
SMILES:CC1(C)OB(OC1(C)C)C2=CC(OCCC)=CC(C)=C2
Synonyms:
  • 4,4,5,5-Tetramethyl-2-(3-methyl-5-propoxyphenyl)-1,3,2-dioxaborolane
  • 1,3,2-Dioxaborolane, 4,4,5,5-tetramethyl-2-(3-methyl-5-propoxyphenyl)-
Found 4 products.