CymitQuimica logo

CAS 1219080-77-9

:

2-(Di-1-adamantylphosphino)dimethylaminobenzene

Description:
2-(Di-1-adamantylphosphino)dimethylaminobenzene is a chemical compound characterized by its unique structure, which includes a dimethylamino group and two adamantyl groups attached to a phosphine moiety. This compound belongs to the class of phosphine ligands, which are often utilized in coordination chemistry and catalysis due to their ability to stabilize metal complexes. The adamantyl groups contribute to the steric bulk and hydrophobic characteristics of the molecule, potentially influencing its reactivity and solubility in various solvents. The presence of the dimethylamino group may enhance the electron-donating properties of the phosphine, making it a strong ligand for transition metals. Additionally, the compound's unique structure may impart interesting electronic properties, making it suitable for applications in organic synthesis and materials science. Its specific interactions and reactivity would depend on the metal center it coordinates with, as well as the reaction conditions employed. Overall, this compound exemplifies the intricate relationship between molecular structure and chemical behavior in organophosphorus chemistry.
Formula:C28H40NP
InChI:InChI=1S/C28H40NP/c1-29(2)25-5-3-4-6-26(25)30(27-13-19-7-20(14-27)9-21(8-19)15-27)28-16-22-10-23(17-28)12-24(11-22)18-28/h3-6,19-24H,7-18H2,1-2H3
InChI key:MILNYLCUWRWYBI-UHFFFAOYSA-N
SMILES:CN(C)C1=CC=CC=C1P(C23CC4CC(C2)CC(C4)C3)C56CC7CC(C5)CC(C7)C6
Synonyms:
  • Bis(Adamant-1-Yl)(2-Dimethylaminophenyl)Phosphine
Found 5 products.