CymitQuimica logo

CAS 1219426-63-7

:

4-Benzyl-Morpholine-3-Carboxylic Acid

Description:
4-Benzyl-Morpholine-3-Carboxylic Acid is a chemical compound characterized by its morpholine ring structure, which is a six-membered heterocyclic amine containing one nitrogen atom. This compound features a benzyl group attached to the fourth position of the morpholine ring and a carboxylic acid functional group at the third position. The presence of the benzyl group contributes to its lipophilicity, potentially enhancing its ability to cross biological membranes. The carboxylic acid group imparts acidic properties, allowing for potential interactions in various chemical environments, including hydrogen bonding and salt formation. This compound may exhibit biological activity, making it of interest in pharmaceutical research, particularly in the development of drugs targeting specific receptors or enzymes. Its molecular structure suggests potential applications in medicinal chemistry, where modifications to the morpholine core can lead to derivatives with enhanced efficacy or selectivity. As with many organic compounds, its stability, solubility, and reactivity will depend on the specific conditions under which it is handled.
Formula:C12H15NO3
InChI:InChI=1S/C12H15NO3/c14-12(15)11-9-16-7-6-13(11)8-10-4-2-1-3-5-10/h1-5,11H,6-9H2,(H,14,15)
InChI key:XZVHBJHXLYHSNN-UHFFFAOYSA-N
SMILES:C1COCC(N1CC2=CC=CC=C2)C(=O)O
Found 4 products.