CymitQuimica logo

CAS 1219803-98-1

:

Heptanoic-6,6,7,7,7-d5 acid

Description:
Heptanoic-6,6,7,7,7-d5 acid, also known as deuterated heptanoic acid, is a deuterated fatty acid characterized by the presence of five deuterium atoms, which are isotopes of hydrogen, replacing the hydrogen atoms at the 6th and 7th positions of the heptanoic acid chain. This modification alters its physical and chemical properties, such as its mass and nuclear magnetic resonance (NMR) characteristics, making it useful in various analytical applications, particularly in studies involving NMR spectroscopy. Heptanoic acid itself is a straight-chain saturated fatty acid with a seven-carbon backbone, exhibiting typical fatty acid properties, including being a colorless liquid at room temperature and having a characteristic fatty odor. Its deuterated form is often utilized in research settings, particularly in metabolic studies and tracer experiments, due to the unique properties imparted by the deuterium labeling. The presence of deuterium enhances the resolution of NMR signals, allowing for more precise tracking of molecular interactions and dynamics in biological systems.
Formula:C7H9D5O2
InChI:InChI=1S/C7H14O2/c1-2-3-4-5-6-7(8)9/h2-6H2,1H3,(H,8,9)/i1D3,2D2
InChI key:InChIKey=MNWFXJYAOYHMED-ZBJDZAJPSA-N
SMILES:C(CC(O)=O)CCC(C([2H])([2H])[2H])([2H])[2H]
Synonyms:
  • Heptanoic-6,6,7,7,7-d5 acid
Found 3 products.