CymitQuimica logo

CAS 1219804-65-5

:

2-Phenoxyethyl--d4 Alcohol

Description:
2-Phenoxyethyl-d4 alcohol, with the CAS number 1219804-65-5, is a deuterated form of 2-phenoxyethyl alcohol, which is an organic compound characterized by the presence of a phenoxy group (C6H5O-) attached to a two-carbon ethyl chain ending in a hydroxyl group (-OH). The "d4" designation indicates that four hydrogen atoms in the molecule have been replaced with deuterium, a stable isotope of hydrogen, which is often used in NMR spectroscopy and other analytical techniques to trace molecular behavior and interactions. This compound typically exhibits properties such as moderate solubility in water and organic solvents, and it may serve as a solvent or intermediate in chemical synthesis. Its deuterated nature can enhance the sensitivity and resolution of spectroscopic studies. Additionally, the presence of the phenoxy group may impart specific reactivity and functional characteristics, making it useful in various applications, including pharmaceuticals and materials science.
Formula:C8H6D4O2
InChI:InChI=1S/C8H10O2/c9-6-7-10-8-4-2-1-3-5-8/h1-5,9H,6-7H2/i6D2,7D2
InChI key:QCDWFXQBSFUVSP-KXGHAPEVSA-N
SMILES:[2H]C([2H])(C([2H])([2H])OC1=CC=CC=C1)O
Synonyms:
  • Phenoxyethanol-D4
  • 2-Phenoxyethyl--d4 Alcohol
  • 1,1,2,2-tetradeuterio-2-phenoxyethanol
Found 2 products.