CAS 1219805-23-8
:methyl-d3)
Description:
Methyl-d3, also known as deuterated methyl group, is a chemical compound where three hydrogen atoms in a methyl group (–CH3) are replaced by deuterium isotopes (–CD3). This substitution results in a compound that retains the same molecular formula as regular methyl but exhibits distinct physical and chemical properties due to the presence of deuterium, which has a greater mass than hydrogen. Methyl-d3 is often used in various applications, including NMR spectroscopy, where it serves as a solvent or reference standard, allowing for enhanced resolution and sensitivity in spectral analysis. The presence of deuterium can also influence reaction kinetics and mechanisms, making it valuable in studies of reaction pathways. Additionally, the compound is utilized in labeling studies in organic chemistry and biochemistry, aiding in the tracing of metabolic pathways. Its unique isotopic composition can also provide insights into molecular dynamics and interactions in complex systems.
Formula:C8H8O
InChI:InChI=1S/C8H8O/c1-7-2-4-8(6-9)5-3-7/h2-6H,1H3/i1D3,2D,3D,4D,5D
InChI key:InChIKey=FXLOVSHXALFLKQ-AAYPNNLASA-N
SMILES:C(=O)C1=C(C(=C(C([2H])([2H])[2H])C(=C1[2H])[2H])[2H])[2H]
Synonyms:- [Synonyms]
Filter by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
p-Tolualdehyde-d7 (2,3,5,6-d4; methyl-d3)
CAS:Controlled ProductApplications p-Tolualdehyde-d7 (2,3,5,6-d4; methyl-d3) (CAS# 1219805-23-8) is a useful isotopically labeled research compound.
Formula:C8D7HOColor and Shape:NeatMolecular weight:127.19
