CAS 1219805-88-5

4'-BROMOACETOPHENONE-D7

Description:

4'-Bromoacetophenone-D7 is a deuterated derivative of 4-bromoacetophenone, which is an aromatic ketone. This compound features a bromine atom and an acetyl group attached to a phenyl ring, making it a useful reagent in organic synthesis and analytical chemistry. The "D7" designation indicates that the compound contains seven deuterium atoms, which are isotopes of hydrogen, replacing regular hydrogen atoms in the molecular structure. This isotopic labeling enhances the compound's utility in NMR spectroscopy and other analytical techniques, allowing for more precise tracking of molecular behavior and interactions. The presence of the bromine atom contributes to the compound's reactivity, making it suitable for various substitution reactions. Additionally, the compound is typically characterized by its melting point, boiling point, solubility in organic solvents, and spectral properties, which can be analyzed using techniques such as NMR, IR, and mass spectrometry. Overall, 4'-Bromoacetophenone-D7 serves as a valuable tool in both research and industrial applications, particularly in the fields of pharmaceuticals and materials science.

Formula: C₈BrD₇O

InChI: InChI=1S/C8H7BrO/c1-6(10)7-2-4-8(9)5-3-7/h2-5H,1H3/i1D3,2D,3D,4D,5D

InChI key: WYECURVXVYPVAT-AAYPNNLASA-N

SMILES: [2H]C1=C(C(=C(C(=C1C(=O)C([2H])([2H])[2H])[2H])[2H])Br)[2H]

Synonyms:

• 4'-BROMOACETOPHENONE-D7
• 1-(4-bromophenyl-2,3,5,6-d4)ethan-1-one-2,2,2-d3
• 4-BROMOACETOPHENONE-D7

4'-Bromoacetophenone-d7

CAS: 1219805-88-5

4'-Bromoacetophenone-d7 (4-Bromoacetophenone-d7) is a deuterium-labeled version of 4'-Bromoacetophenone. This compound serves as a biochemical reagent, suitable for use as a biological material or organic compound in life science research.

Formula: C₈H₇BrO

Molecular weight: 206.09

Ref: TM-TMIT-0375

4'-Bromoacetophenone-d7

CAS: 1219805-88-5, 99-90-1

Formula: BrC₆D₄COCD₃

Purity: 98 atom % D

Color and Shape: White Solid

Molecular weight: 205.01196

Ref: 3U-D5629

4'-Bromoacetophenone-d7

Controlled Product

CAS: 1219805-88-5

Formula: C₈D₇BrO

Color and Shape: Neat

Molecular weight: 206.0877

Ref: TR-B679061