
CAS 122046-79-1
:L-threo-Hex-2-enaric acid, 1,4-lactone, 6-methyl ester
Description:
L-threo-Hex-2-enaric acid, 1,4-lactone, 6-methyl ester, identified by CAS number 122046-79-1, is a chemical compound characterized by its unique structural features. It is a lactone, which indicates that it contains a cyclic ester formed from the reaction of an alcohol and a carboxylic acid. The presence of the "L-threo" configuration suggests specific stereochemistry, which can influence its biological activity and reactivity. The "Hex-2-enaric" part of the name indicates that it is derived from a hexenoic acid, featuring a double bond and a carboxylic acid functional group, contributing to its reactivity. The methyl ester group signifies that the carboxylic acid has been esterified with methanol, enhancing its solubility and stability in various solvents. This compound may exhibit interesting properties such as potential biological activity, making it of interest in fields like medicinal chemistry and biochemistry. Its specific applications and behavior would depend on further studies and characterization in laboratory settings.
Formula:C7H8O7
InChI:InChI=1S/C7H8O7/c1-13-6(11)4(10)5-2(8)3(9)7(12)14-5/h4-5,8-10H,1H3/t4-,5+/m1/s1
InChI key:YDPRPKPHLCWZNT-UHNVWZDZSA-N
SMILES:COC(=O)[C@@H]([C@@H]1C(=C(C(=O)O1)O)O)O
Synonyms:- L-threo-Hex-2-enaric acid, 1,4-lactone, 6-methyl ester (9CI)
- YDPRPKPHLCWZNT-UHNVWZDZSA-N
- Ascorbic Acid EP Impurity H
- Methyl (2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2,5-dihydrofuran-2-yl]-2-hydroxyacetate
- Sodium Ascorbate EP Impurity H
- L-threo-Hex-2-enaric acid, 1,4-lactone, 6-methyl ester
- Ascorbic Acid Impurity 8(Ascorbic Acid EP Impurity H)
- Ascorbic acid Imp H (EP) : methyl (2R)-2-[(2R)-3,4-dihydroxy-5-oxo-2,5-dihydrofuran-2-yl]-2-hydroxyacetate
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
(R)-Methyl 2-((R)-3,4-dihydroxy-5-oxo-2,5-dihydrofuran-2-yl)-2-hydroxyacetate
CAS:(R)-Methyl 2-((R)-3,4-dihydroxy-5-oxo-2,5-dihydrofuran-2-yl)-2-hydroxyacetateFormula:C7H8O7Purity:98%Molecular weight:204.13Ascorbic Acid EP Impurity H
CAS:Formula:C7H8O7Color and Shape:Pale Brown SolidMolecular weight:204.13(R)-Methyl 2-((R)-3,4-dihydroxy-5-oxo-2,5-dihydrofuran-2-yl)-2-hydroxyacetate
CAS:(R)-Methyl 2-((R)-3,4-dihydroxy-5-oxo-2,5-dihydrofuran-2-yl)-2-hydroxyacetateFormula:C7H8O7Purity:98%Molecular weight:204.13L-threo-Hex-2-enaric acid 1,4-Lactone 6-Methyl Ester
CAS:Formula:C7H8O7Color and Shape:NeatMolecular weight:204.13Methyl (R)-2-((R)-3,4-dihydroxy-5-oxo-2,5-dihydrofuran-2-yl)-2-hydroxyacetate
CAS:Controlled ProductFormula:C7H8O7Color and Shape:NeatMolecular weight:204.13L-Threo-hex-2-enaric acid 1,4-lactone 6-methyl ester
CAS:L-Threo-hex-2-enaric acid 1,4-lactone 6-methyl ester is a research and development compound. It is a metabolite of the drug product L-Threo-hex-2-enaric acid 1,4-lactone 6-(2,6,6)-trimethyl ester. L-Threo-hex-2-enaric acid 1,4-lactone 6-(2,6,6)-trimethyl ester (LTA) is an impurity in the drug product that is present as a result of its synthesis. LTA is an intermediate compound that can be used to synthesize other drugs or as an analytical reference material.
Formula:C7H8O7Purity:Min. 95%Molecular weight:204.13 g/mol






