CymitQuimica logo

CAS 1220509-29-4

:

2,3-Difluoro-1,4-benzenedicarboxylic acid

Description:
2,3-Difluoro-1,4-benzenedicarboxylic acid is an aromatic dicarboxylic acid characterized by the presence of two carboxylic acid groups (-COOH) and two fluorine atoms substituted on a benzene ring. The fluorine atoms are located at the 2 and 3 positions relative to the carboxylic acid groups, which are positioned at the 1 and 4 positions, giving the compound its unique reactivity and properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the carboxylic acid groups. The fluorine substituents can influence the acidity and reactivity of the carboxylic acid groups, potentially enhancing their electrophilic character. Additionally, the presence of fluorine can affect the compound's physical properties, such as melting point and boiling point, as well as its interactions in various chemical environments. 2,3-Difluoro-1,4-benzenedicarboxylic acid may find applications in organic synthesis, materials science, and as a building block in the development of fluorinated compounds.
Formula:C8H4F2O4
InChI:InChI=1S/C8H4F2O4/c9-5-3(7(11)12)1-2-4(6(5)10)8(13)14/h1-2H,(H,11,12)(H,13,14)
InChI key:InChIKey=HSASJEUDAQEILE-UHFFFAOYSA-N
SMILES:C(O)(=O)C1=C(F)C(F)=C(C(O)=O)C=C1
Synonyms:
  • 2,3-Difluoro-1,4-benzenedicarboxylic acid
  • 2,3-Difluoroterephthalic acid
  • 1,4-Benzenedicarboxylic acid, 2,3-difluoro-
Found 6 products.