CymitQuimica logo

CAS 1220910-89-3

:

N-[3-Fluoro-4-[6-(2-methyl-2H-tetrazol-5-yl)-3-pyridinyl]phenyl]carbamic acid phenylmethyl ester

Description:
N-[3-Fluoro-4-[6-(2-methyl-2H-tetrazol-5-yl)-3-pyridinyl]phenyl]carbamic acid phenylmethyl ester, with CAS number 1220910-89-3, is a chemical compound characterized by its complex structure, which includes a fluorinated phenyl group, a pyridine moiety, and a tetrazole ring. This compound is likely to exhibit properties typical of carbamate derivatives, such as potential biological activity, which may include inhibition of specific enzymes or receptors. The presence of the fluorine atom can enhance lipophilicity and metabolic stability, while the tetrazole ring may contribute to its pharmacological profile. The compound's solubility, stability, and reactivity can be influenced by its functional groups and overall molecular architecture. Such compounds are often investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various diseases. Understanding its characteristics requires further studies, including spectroscopic analysis and biological assays, to elucidate its behavior in different environments and its interactions with biological systems.
Formula:C21H17FN6O2
InChI:InChI=1S/C21H17FN6O2/c1-28-26-20(25-27-28)19-10-7-15(12-23-19)17-9-8-16(11-18(17)22)24-21(29)30-13-14-5-3-2-4-6-14/h2-12H,13H2,1H3,(H,24,29)
InChI key:GIBJIBYBOVNDET-UHFFFAOYSA-N
SMILES:CN1N=C(N=N1)C2=NC=C(C=C2)C3=C(C=C(C=C3)NC(=O)OCC4=CC=CC=C4)F
Synonyms:
  • Carbamic acid, N-[3-fluoro-4-[6-(2-Methyl-2H-tetrazol-5-yl)-3-pyridinyl]phenyl]-, phenylMethyl ester
  • N-(3-Fluoro-4-(6-(2-methyl-2H-tetrazol-5-yl)-3-pyridinyl]phenyl)carbamic acid phenylmethyl ester
Found 9 products.