CymitQuimica logo

CAS 122111-05-1

:

4-Amino-1-(2-deoxy-2,2-difluoro-a-D-erythro-pentofuranosyl)-2(1H)-pyrimidinone Hydrochloride

Description:
4-Amino-1-(2-deoxy-2,2-difluoro-α-D-erythro-pentofuranosyl)-2(1H)-pyrimidinone hydrochloride is a synthetic nucleoside analog with notable antiviral properties, particularly against viral infections such as HIV. This compound features a pyrimidinone base linked to a modified sugar moiety, which enhances its stability and bioavailability. The presence of difluorination in the sugar component contributes to its unique pharmacological profile, potentially improving its efficacy and selectivity. As a hydrochloride salt, it is typically more soluble in aqueous solutions, facilitating its use in pharmaceutical formulations. The compound's structure allows it to interfere with nucleic acid synthesis in viral replication processes, making it a candidate for therapeutic applications. In terms of safety and handling, like many chemical substances, it should be managed with appropriate precautions due to its biological activity. Overall, this compound exemplifies the ongoing efforts in medicinal chemistry to develop effective antiviral agents through structural modifications of nucleoside analogs.
Formula:C9H12ClF2N3O4
InChI:InChI=1/C9H11F2N3O4.ClH/c10-9(11)6(16)4(3-15)18-7(9)14-2-1-5(12)13-8(14)17;/h1-2,4,6-7,15-16H,3H2,(H2,12,13,17);1H/t4-,6+,7+;/m1./s1
InChI key:OKKDEIYWILRZIA-DNSZWREKSA-N
SMILES:C1=CN(C(=O)N=C1N)[C@@H]2C([C@H]([C@H](O2)CO)O)(F)F.Cl
Synonyms:
  • 1’-Epi Gemcitabine Hydrochloride
Found 9 products.