CymitQuimica logo

CAS 1221153-84-9

:

1-[1-(1-Methylethyl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethanone

Description:
1-[1-(1-Methylethyl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethanone, with the CAS number 1221153-84-9, is a chemical compound that features a complex structure incorporating a pyrrolopyridine moiety. This substance is characterized by the presence of a ketone functional group, which contributes to its reactivity and potential applications in organic synthesis. The compound's structure includes an isopropyl group, which can influence its steric properties and solubility in various solvents. As a member of the pyridine family, it may exhibit biological activity, making it of interest in medicinal chemistry and drug development. The specific interactions and properties of this compound can vary based on its environment, including factors such as pH and temperature. Additionally, its synthesis and characterization would typically involve standard organic chemistry techniques, including spectroscopic methods for confirmation of structure. Overall, this compound represents a unique scaffold that could be explored for various chemical and pharmaceutical applications.
Formula:C12H14N2O
InChI:InChI=1S/C12H14N2O/c1-8(2)14-7-11(9(3)15)10-4-5-13-6-12(10)14/h4-8H,1-3H3
InChI key:InChIKey=JRXMCKDWYVVJMJ-UHFFFAOYSA-N
SMILES:C(C)(=O)C=1C=2C(N(C(C)C)C1)=CN=CC2
Synonyms:
  • Ethanone, 1-[1-(1-methylethyl)-1H-pyrrolo[2,3-c]pyridin-3-yl]-
  • 1-(1-Isopropyl-1H-pyrrolo[2,3-c]pyridin-3-yl)ethanone
  • 1-(1-Propan-2-ylpyrrolo[2,3-c]pyridin-3-yl)ethanone
  • 1-[1-(1-Methylethyl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethanone
  • 1-[1-(Propan-2-yl)-1H-pyrrolo[2,3-c]pyridin-3-yl]ethan-1-one
Found 2 products.