CymitQuimica logo

CAS 1221272-90-7

:

Azetidine, 3-(trifluoromethyl)-, hydrochloride (1:1)

Description:
Azetidine, 3-(trifluoromethyl)-, hydrochloride (1:1) is a chemical compound characterized by its azetidine ring structure, which is a four-membered saturated heterocyclic compound containing one nitrogen atom. The presence of a trifluoromethyl group (-CF3) at the 3-position of the azetidine ring significantly influences its chemical properties, enhancing lipophilicity and potentially affecting its biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which is advantageous for various applications, including pharmaceutical formulations. The compound may exhibit interesting pharmacological properties due to the trifluoromethyl group, which is known to modulate the activity of organic molecules. Its CAS number, 1221272-90-7, allows for precise identification in chemical databases. Overall, this compound's unique structural features and properties make it a subject of interest in medicinal chemistry and related fields.
Formula:C4H6F3N·ClH
InChI:InChI=1S/C4H6F3N.ClH/c5-4(6,7)3-1-8-2-3;/h3,8H,1-2H2;1H
InChI key:InChIKey=BKIWJBSPWANURM-UHFFFAOYSA-N
SMILES:C(F)(F)(F)C1CNC1.Cl
Synonyms:
  • Azetidine, 3-(trifluoromethyl)-, hydrochloride (1:1)
  • 3-(Trifluoromethyl)azetidine hydrochloride
Found 5 products.