CymitQuimica logo

CAS 1221791-62-3

:

rel-(3R,4R)-1-(Phenylmethyl)-4-(2-pyridinyl)-3-pyrrolidinecarboxylic acid

Description:
The chemical substance known as rel-(3R,4R)-1-(Phenylmethyl)-4-(2-pyridinyl)-3-pyrrolidinecarboxylic acid, with the CAS number 1221791-62-3, is a chiral compound featuring a pyrrolidine ring, which is a five-membered nitrogen-containing heterocycle. This compound exhibits specific stereochemistry, indicated by the (3R,4R) configuration, which is crucial for its biological activity and interactions. The presence of a phenylmethyl group and a pyridine moiety contributes to its potential pharmacological properties, as these functional groups can influence binding affinity and selectivity towards biological targets. The carboxylic acid functional group suggests that the compound may exhibit acidic properties, which can affect its solubility and reactivity in various environments. Additionally, the compound's chirality may play a significant role in its efficacy and safety profile in medicinal applications. Overall, this substance is of interest in the field of medicinal chemistry, particularly for its potential therapeutic applications.
Formula:C17H18N2O2
InChI:InChI=1/C17H18N2O2/c20-17(21)15-12-19(10-13-6-2-1-3-7-13)11-14(15)16-8-4-5-9-18-16/h1-9,14-15H,10-12H2,(H,20,21)/t14-,15-/s2
InChI key:InChIKey=ROBXPKYRUKXCDH-PTTDRDKLNA-N
SMILES:C(O)(=O)[C@@H]1[C@H](CN(CC2=CC=CC=C2)C1)C3=CC=CC=N3
Synonyms:
  • 3-Pyrrolidinecarboxylic acid, 1-(phenylmethyl)-4-(2-pyridinyl)-, (3R,4R)-rel-
  • rel-(3R,4R)-1-(Phenylmethyl)-4-(2-pyridinyl)-3-pyrrolidinecarboxylic acid
Found 1 products.