CymitQuimica logo

CAS 1221931-40-3

:

1,1-Dimethylethyl 2-chloro-6,7-dihydrothiazolo[5,4-c]pyridine-5(4H)-carboxylate

Description:
1,1-Dimethylethyl 2-chloro-6,7-dihydrothiazolo[5,4-c]pyridine-5(4H)-carboxylate is a chemical compound characterized by its complex structure, which includes a thiazole and pyridine ring system. The presence of a chloro substituent and a carboxylate group contributes to its reactivity and potential applications in various chemical reactions. This compound is likely to exhibit moderate to high lipophilicity due to the presence of the bulky tert-butyl group, which can influence its solubility and permeability in biological systems. The thiazolo-pyridine framework may impart biological activity, making it of interest in medicinal chemistry for potential pharmacological applications. Additionally, the compound's stability and reactivity can be influenced by the electronic effects of the substituents, particularly the electron-withdrawing chlorine atom. Overall, this compound represents a unique structure that may be explored for its chemical properties and potential uses in drug development or as a synthetic intermediate in organic chemistry.
Formula:C11H15ClN2O2S
InChI:InChI=1S/C11H15ClN2O2S/c1-11(2,3)16-10(15)14-5-4-7-8(6-14)17-9(12)13-7/h4-6H2,1-3H3
InChI key:InChIKey=PVRYZNJYTDBLDW-UHFFFAOYSA-N
SMILES:C(OC(C)(C)C)(=O)N1CC2=C(CC1)N=C(Cl)S2
Synonyms:
  • Thiazolo[5,4-c]pyridine-5(4H)-carboxylic acid, 2-chloro-6,7-dihydro-, 1,1-dimethylethyl ester
  • 1,1-Dimethylethyl 2-chloro-6,7-dihydrothiazolo[5,4-c]pyridine-5(4H)-carboxylate
Found 3 products.