CymitQuimica logo

CAS 122222-09-7

:

1,2-dimethyl-1H-imidazole-5-carboxylicacid

Description:
1,2-Dimethyl-1H-imidazole-5-carboxylic acid is an organic compound characterized by its imidazole ring structure, which is a five-membered heterocyclic ring containing two nitrogen atoms. This compound features two methyl groups attached to the first carbon of the imidazole ring and a carboxylic acid functional group at the fifth position. The presence of the carboxylic acid group imparts acidic properties, allowing it to participate in various chemical reactions, including esterification and amidation. The methyl substituents can influence the compound's solubility and reactivity, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. Additionally, the imidazole ring is known for its biological significance, often found in various natural products and biomolecules, such as histidine and certain alkaloids. The compound's unique structure may also contribute to its potential as a ligand in coordination chemistry or as a building block in organic synthesis. Overall, 1,2-dimethyl-1H-imidazole-5-carboxylic acid is a versatile compound with interesting chemical properties.
Formula:C6H8N2O2
InChI:InChI=1S/C6H8N2O2/c1-4-7-3-5(6(9)10)8(4)2/h3H,1-2H3,(H,9,10)
InChI key:GHSZJLADCHKTGG-UHFFFAOYSA-N
SMILES:CC1=NC=C(N1C)C(=O)O
Synonyms:
  • 2,3-diMethyliMidazole-4-carboxylic acid
  • 1,2-dimethyl-1H-imidazole-5-carboxylicacid
Found 4 products.