CAS 122323-88-0
:Piperazine-2-carboxylic acid methyl ester dihydrochloride
Description:
Piperazine-2-carboxylic acid methyl ester dihydrochloride is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a carboxylic acid moiety that is esterified with a methyl group, enhancing its solubility and reactivity. The presence of two hydrochloride groups indicates that it exists as a dihydrochloride salt, which typically improves its stability and solubility in aqueous solutions. This compound is often utilized in pharmaceutical research and development due to its potential biological activity, particularly in the context of drug design and synthesis. Its structural properties allow for various modifications, making it a versatile intermediate in organic synthesis. Additionally, the piperazine ring is known for its role in various pharmacological applications, including as an anxiolytic and antidepressant agent. Overall, Piperazine-2-carboxylic acid methyl ester dihydrochloride is a significant compound in medicinal chemistry, with implications for therapeutic development.
Formula:C6H14Cl2N2O2
InChI:InChI=1/C6H12N2O2.2ClH/c1-10-6(9)5-4-7-2-3-8-5;;/h5,7-8H,2-4H2,1H3;2*1H
SMILES:COC(=O)C1CNCCN1.Cl.Cl
Synonyms:- Piperazine-2-Carboxylic Acid Methyl Ester 2HCl
- [2758-98-7],C6H12N2O2, 144.09
- Methylester, Monohydrochloride
- Methyl Piperazine-2-Carboxylate Dihydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Piperazine-2-carboxylic acid methyl ester DiHCl
CAS:Formula:C6H14Cl2N2O2Purity:97%Color and Shape:SolidMolecular weight:217.0936Piperazine-2-Carboxylic Acid Methyl Ester Dihydrochloride
CAS:Piperazine-2-Carboxylic Acid Methyl Ester DihydrochloridePurity:97%Molecular weight:217.09g/molPiperazine-2-carboxylic acid methyl ester dihydrochloride
CAS:Formula:C6H14Cl2N2O2Purity:97%Color and Shape:SolidMolecular weight:217.09Piperazine-2-carboxylic Acid Methyl Ester Dihydrochloride
CAS:Formula:C6H12N2O2·2HClColor and Shape:NeatPiperazine-2-carboxylic acid methyl esterdihydrochloride
CAS:Piperazine-2-carboxylic acid methyl ester (PPCM) is a chemical compound that is used as an intermediate in the production of ethylenediamine and piperazine-2-carboxylic acid dihydrochloride. It is a white crystalline solid that can be synthesized by reacting ethylene diamine with piperazine-2-carboxylic acid. PPCM has been shown to inhibit the growth of bacteria, yeast, and fungi by inhibiting protein synthesis. This chemical also inhibits the production of proteins essential for respiration and cell wall formation.Formula:C6H14Cl2N2O2Purity:Min. 95%Molecular weight:217.09 g/mol





