CymitQuimica logo

CAS 122323-88-0

:

Piperazine-2-carboxylic acid methyl ester dihydrochloride

Description:
Piperazine-2-carboxylic acid methyl ester dihydrochloride is a chemical compound characterized by its piperazine core, which is a six-membered ring containing two nitrogen atoms. This compound features a carboxylic acid moiety that is esterified with a methyl group, enhancing its solubility and reactivity. The presence of two hydrochloride groups indicates that it exists as a dihydrochloride salt, which typically improves its stability and solubility in aqueous solutions. This compound is often utilized in pharmaceutical research and development due to its potential biological activity, particularly in the context of drug design and synthesis. Its structural properties allow for various modifications, making it a versatile intermediate in organic synthesis. Additionally, the piperazine ring is known for its role in various pharmacological applications, including as an anxiolytic and antidepressant agent. Overall, Piperazine-2-carboxylic acid methyl ester dihydrochloride is a significant compound in medicinal chemistry, with implications for therapeutic development.
Formula:C6H14Cl2N2O2
InChI:InChI=1/C6H12N2O2.2ClH/c1-10-6(9)5-4-7-2-3-8-5;;/h5,7-8H,2-4H2,1H3;2*1H
InChI key:ZBYFDUSYNDLSND-UHFFFAOYSA-N
SMILES:COC(=O)C1CNCCN1.Cl.Cl
Synonyms:
  • Piperazine-2-Carboxylic Acid Methyl Ester 2HCl
  • [2758-98-7],C6H12N2O2, 144.09
  • Methylester, Monohydrochloride
  • Methyl Piperazine-2-Carboxylate Dihydrochloride
Found 7 products.