CymitQuimica logo

CAS 1224945-46-3

:

(R)-tert-butyl 2-(2-bromophenyl)pyrrolidine-1-carboxylate

Description:
(R)-tert-butyl 2-(2-bromophenyl)pyrrolidine-1-carboxylate is a chemical compound characterized by its chiral pyrrolidine structure, which contributes to its potential biological activity. The presence of the tert-butyl group enhances its lipophilicity, making it more soluble in organic solvents. The 2-bromophenyl substituent introduces a halogen atom, which can influence the compound's reactivity and interaction with biological targets. This compound is typically used in organic synthesis and medicinal chemistry, particularly in the development of pharmaceuticals. Its stereochemistry, indicated by the (R) configuration, is crucial for its biological activity, as different enantiomers can exhibit significantly different properties. The carboxylate functional group plays a role in the compound's acidity and can participate in various chemical reactions, such as esterification or amidation. Overall, (R)-tert-butyl 2-(2-bromophenyl)pyrrolidine-1-carboxylate is a versatile compound with applications in research and development within the field of chemistry.
Formula:C15H20BrNO2
InChI:InChI=1S/C15H20BrNO2/c1-15(2,3)19-14(18)17-10-6-9-13(17)11-7-4-5-8-12(11)16/h4-5,7-8,13H,6,9-10H2,1-3H3/t13-/m1/s1
InChI key:RNZCQSVBUGGMJB-CYBMUJFWSA-N
SMILES:CC(C)(C)OC(=O)N1CCC[C@@H]1C2=CC=CC=C2Br
Synonyms:
  • tert-butyl (R)-2-(2-bromophenyl)pyrrolidine-1-carboxylate
  • 1-Pyrrolidinecarboxylic acid, 2-(2-bromophenyl)-, 1,1-dimethylethyl ester, (2R)-
  • (R)-tert-butyl 2-(2-bromophenyl)pyrrolidine-1-carboxylate
Found 2 products.