CymitQuimica logo

CAS 1225462-38-3

:

1,2,4-Oxadiazole-3-methanamine, α,5-dimethyl-, hydrochloride (1:1), (αR)-

Description:
1,2,4-Oxadiazole-3-methanamine, α,5-dimethyl-, hydrochloride (1:1), (αR)- is a chemical compound characterized by its oxadiazole ring structure, which contributes to its unique reactivity and potential biological activity. The presence of the methanamine group indicates that it has amine functionalities, which can participate in hydrogen bonding and influence solubility in polar solvents. The α,5-dimethyl substitution suggests steric hindrance, which may affect the compound's interaction with biological targets. As a hydrochloride salt, it is typically more stable and soluble in aqueous solutions compared to its free base form, making it suitable for various applications, including pharmaceutical formulations. The compound's chirality, denoted by (αR)-, indicates that it exists in a specific stereoisomeric form, which can significantly impact its pharmacological properties. Overall, this compound's structural features suggest potential utility in medicinal chemistry, particularly in the development of new therapeutic agents. However, specific biological activities and safety profiles would require further investigation through empirical studies.
Formula:C5H9N3O·ClH
InChI:InChI=1S/C5H9N3O.ClH/c1-3(6)5-7-4(2)9-8-5;/h3H,6H2,1-2H3;1H/t3-;/m1./s1
InChI key:InChIKey=YRFQYNOIIKXUJM-AENDTGMFSA-N
SMILES:[C@H](C)(N)C=1N=C(C)ON1.Cl
Synonyms:
  • (R)-1-(5-Methyl-1,2,4-oxadiazol-3-yl)ethan-1-amine hydrochloride
  • 1,2,4-Oxadiazole-3-methanamine, α,5-dimethyl-, hydrochloride (1:1), (αR)-
Found 2 products.