CymitQuimica logo

CAS 1227040-87-0

:

[4-(1,2,2-triphenylethenyl)phenyl]boronic acid

Description:
[4-(1,2,2-Triphenylethenyl)phenyl]boronic acid is an organoboron compound characterized by the presence of a boronic acid functional group, which is known for its ability to form reversible covalent bonds with diols. This compound features a phenyl group substituted with a triphenylethenyl moiety, contributing to its unique electronic and steric properties. The presence of multiple phenyl rings enhances its stability and can influence its solubility in organic solvents. Typically, boronic acids are utilized in organic synthesis, particularly in Suzuki coupling reactions, which are pivotal for forming carbon-carbon bonds. This compound may exhibit interesting photophysical properties due to its conjugated structure, making it potentially useful in materials science and organic electronics. Additionally, the boronic acid group can participate in various chemical reactions, including those involving biomolecules, which may have implications in medicinal chemistry. Overall, [4-(1,2,2-triphenylethenyl)phenyl]boronic acid is a versatile compound with applications in synthetic organic chemistry and materials development.
Formula:C26H21BO2
InChI:InChI=1S/C26H21BO2/c28-27(29)24-18-16-23(17-19-24)26(22-14-8-3-9-15-22)25(20-10-4-1-5-11-20)21-12-6-2-7-13-21/h1-19,28-29H
InChI key:XSIVQWOJIOHPIZ-UHFFFAOYSA-N
SMILES:B(C1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4)(O)O
Synonyms:
  • B-[4-(1,2,2-Triphenylethenyl)phenyl]boronic acid
  • Boronic acid, B-[4-(1,2,2-triphenylethenyl)phenyl]-
  • 4-(1,2,2-triphenylvinyl)phenylboronic acid
  • [4-(1,2,2-triphenylethenyl)phenyl]boronic acid
  • 2-triphenylethenyl)phenyl]boronic acid
Found 4 products.