CAS 122752-16-3: tyr-D-ala-phe-glu-val-val-gly amide
Description:Tyr-D-Ala-Phe-Glu-Val-Val-Gly amide, identified by its CAS number 122752-16-3, is a synthetic peptide that exhibits characteristics typical of peptide compounds. It consists of a sequence of amino acids, including tyrosine (Tyr), D-alanine (D-Ala), phenylalanine (Phe), glutamic acid (Glu), valine (Val), and glycine (Gly), with an amide functional group at the terminal end. This structure contributes to its potential biological activity, which may include interactions with specific receptors or enzymes in biological systems. Peptides like this one are often studied for their roles in pharmacology, particularly in drug design and development, due to their ability to mimic natural biological processes. The presence of D-amino acids, such as D-Ala, can enhance stability against enzymatic degradation, making such peptides more suitable for therapeutic applications. Additionally, the hydrophobic and polar characteristics of the amino acids in the sequence can influence the peptide's solubility, folding, and overall bioactivity.
Formula:C38H54N8O10
InChI:InChI=1/C38H54N8O10/c1-20(2)31(37(55)41-19-29(40)48)46-38(56)32(21(3)4)45-35(53)27(15-16-30(49)50)43-36(54)28(18-23-9-7-6-8-10-23)44-33(51)22(5)42-34(52)26(39)17-24-11-13-25(47)14-12-24/h6-14,20-22,26-28,31-32,47H,15-19,39H2,1-5H3,(H2,40,48)(H,41,55)(H,42,52)(H,43,54)(H,44,51)(H,45,53)(H,46,56)(H,49,50)/t22-,26+,27+,28+,31+,32?/m1/s1
- Synonyms:
- H-Tyr-D-Ala-Phe-Glu-Val-Val-Gly-NH2
- Deltorphin II
- L-tyrosyl-D-alanyl-L-phenylalanyl-L-alpha-glutamylvalyl-L-valylglycinamide