CymitQuimica logo

CAS 1227678-26-3

:

CEP-32496

Description:
CEP-32496, identified by its CAS number 1227678-26-3, is a small molecule that has garnered attention in the field of medicinal chemistry, particularly for its potential therapeutic applications. It is primarily recognized as a selective inhibitor of certain kinases, which play crucial roles in various cellular processes, including cell proliferation and survival. The compound has been studied for its effects on cancer cells, showing promise in inhibiting tumor growth and enhancing the efficacy of other treatments. CEP-32496 exhibits a specific binding affinity to its target, which contributes to its selectivity and potential for reduced side effects compared to less selective agents. Additionally, its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion, are critical for determining its suitability for clinical use. Ongoing research aims to further elucidate its mechanism of action and optimize its therapeutic profile, making it a compound of interest in the development of targeted cancer therapies.
Formula:C24H23ClF3N5O5
InChI:InChI=1S/C24H22F3N5O5.ClH/c1-23(2,24(25,26)27)19-11-20(32-37-19)31-22(33)30-13-6-5-7-14(8-13)36-21-15-9-17(34-3)18(35-4)10-16(15)28-12-29-21;/h5-12H,1-4H3,(H2,30,31,32,33);1H
InChI key:XCZIYUDQUDWQHI-UHFFFAOYSA-N
SMILES:CC(C)(C1=CC(=NO1)NC(=O)NC2=CC(=CC=C2)OC3=NC=NC4=CC(=C(C=C43)OC)OC)C(F)(F)F.Cl
Found 2 products.