CymitQuimica logo

CAS 1227911-45-6

:

GSK2334470

Description:
GSK2334470, with the CAS number 1227911-45-6, is a chemical compound that has been investigated primarily for its potential therapeutic applications. It is classified as a small molecule and is known to act as a selective inhibitor of certain protein kinases, which play crucial roles in various cellular processes, including cell growth, differentiation, and metabolism. The compound's mechanism of action typically involves the modulation of signaling pathways associated with diseases such as cancer and inflammatory disorders. In terms of its physical and chemical properties, GSK2334470 may exhibit characteristics common to small organic molecules, such as moderate solubility in organic solvents and specific stability under standard laboratory conditions. Its development has been part of research efforts aimed at discovering new treatments, and ongoing studies may further elucidate its efficacy and safety profiles. As with any investigational compound, detailed pharmacokinetic and toxicological studies are essential to understand its potential as a therapeutic agent.
Formula:C25H34N8O
InChI:InChI=1S/C25H34N8O/c1-15-8-9-17(24(34)28-18-6-4-3-5-7-18)14-33(15)22-13-20(29-25(27-2)30-22)16-10-11-19-21(12-16)31-32-23(19)26/h10-13,15,17-18H,3-9,14H2,1-2H3,(H,28,34)(H3,26,31,32)(H,27,29,30)/t15-,17+/m1/s1
InChI key:QLPHOXTXAKOFMU-WBVHZDCISA-N
SMILES:C[C@@H]1CC[C@@H](CN1C2=NC(=NC(=C2)C3=CC4=C(C=C3)C(=NN4)N)NC)C(=O)NC5CCCCC5
Found 7 products.