CymitQuimica logo

CAS 1228566-94-6

:

(S)-tert-butyl 6-oxopiperidin-3-ylcarbamate

Description:
(S)-tert-butyl 6-oxopiperidin-3-ylcarbamate is a chemical compound characterized by its piperidine ring structure, which is a six-membered cyclic amine. The presence of a tert-butyl group contributes to its hydrophobic characteristics, while the carbamate functional group enhances its potential for hydrogen bonding and solubility in polar solvents. The compound features a ketone functional group at the 6-position of the piperidine ring, which can influence its reactivity and stability. As a chiral molecule, it exists in two enantiomeric forms, with the (S)-configuration being of particular interest in pharmaceutical applications due to its potential biological activity. This compound may be utilized in medicinal chemistry for the development of therapeutic agents, and its properties can be further explored through various analytical techniques such as NMR spectroscopy and mass spectrometry. Overall, (S)-tert-butyl 6-oxopiperidin-3-ylcarbamate represents a versatile scaffold for further chemical modifications and investigations in drug design.
Formula:C10H18N2O3
InChI:InChI=1S/C10H18N2O3/c1-10(2,3)15-9(14)12-7-4-5-8(13)11-6-7/h7H,4-6H2,1-3H3,(H,11,13)(H,12,14)/t7-/m1/s1
InChI key:KBNSUMIBERIFIT-SSDOTTSWSA-N
SMILES:CC(C)(C)OC(=O)N[C@@H]1CCC(=O)NC1
Found 4 products.