CymitQuimica logo

CAS 1228631-10-4

:

tert-butyl 4-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-1-carboxylate

Description:
Tert-butyl 4-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-1-carboxylate is a chemical compound characterized by its complex structure, which includes a piperidine ring, a tert-butyl group, and a trifluoro-2-hydroxypropyl substituent. This compound is notable for its trifluoromethyl group, which imparts unique electronic and steric properties, enhancing its potential applications in medicinal chemistry and material science. The presence of the tert-butyl ester group contributes to its lipophilicity, potentially influencing its solubility and permeability in biological systems. Additionally, the hydroxyl group in the trifluoro-2-hydroxypropyl moiety may participate in hydrogen bonding, affecting the compound's reactivity and interaction with biological targets. The compound's molecular structure suggests it may exhibit interesting pharmacological properties, making it a candidate for further research in drug development. As with many fluorinated compounds, it may also possess enhanced metabolic stability. Overall, the unique combination of functional groups in this compound contributes to its distinctive chemical behavior and potential utility in various applications.
Formula:C13H22F3NO3
InChI:InChI=1S/C13H22F3NO3/c1-12(2,3)20-11(19)17-6-4-9(5-7-17)8-10(18)13(14,15)16/h9-10,18H,4-8H2,1-3H3
InChI key:YLPPNASJYIAVQZ-UHFFFAOYSA-N
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)CC(C(F)(F)F)O
Synonyms:
  • 3-(1-Boc-4-piperidyl)-1,1,1-trifluoro-2-propanol
  • tert-butyl 4-(3,3,3-trifluoro-2-hydroxypropyl)piperidine-1-carboxylate
  • 1-Piperidinecarboxylic acid, 4-(3,3,3-trifluoro-2-hydroxypropyl)-, 1,1-dimethylethyl ester
  • 4-(3,3,3-Trifluoro-2-hydroxy-propyl)-piperidine-1-carboxylic acid tert-butyl ester
Found 4 products.