CymitQuimica logo

CAS 1228780-51-5

:

(2-(4-chlorophenyl)-4,4-dimethylcyclohex-1-enyl)methanol

Description:
The chemical substance known as (2-(4-chlorophenyl)-4,4-dimethylcyclohex-1-enyl)methanol, with the CAS number 1228780-51-5, is characterized by its complex structure that includes a cyclohexene ring substituted with a chlorophenyl group and a hydroxymethyl group. This compound features a chiral center, which may lead to the existence of stereoisomers. The presence of the 4-chlorophenyl group suggests potential applications in pharmaceuticals or agrochemicals, as chlorinated aromatic compounds often exhibit significant biological activity. The hydroxymethyl group indicates that the substance may participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the dimethyl substitution on the cyclohexene ring can affect the compound's steric hindrance and overall stability. Its physical properties, such as melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups. Overall, this compound's unique structure and functional groups make it of interest in various chemical research and application fields.
Formula:C15H19ClO
InChI:InChI=1S/C15H19ClO/c1-15(2)8-7-12(10-17)14(9-15)11-3-5-13(16)6-4-11/h3-6,17H,7-10H2,1-2H3
InChI key:ZTRTWRMYWVEPEP-UHFFFAOYSA-N
SMILES:CC1(CCC(=C(C1)C2=CC=C(C=C2)Cl)CO)C
Synonyms:
  • (2-(4-chlorophenyl)-4,4-diMethylcyclohex-1-enyl)Methanol
Found 4 products.