CAS 123-48-8: 2,2,4,6,6-Pentamethyl-3-heptene
Description:2,2,4,6,6-Pentamethyl-3-heptene is an organic compound characterized by its structure as a branched alkene. It features a seven-carbon chain with a double bond located at the third carbon, along with five methyl groups attached to the second, fourth, and sixth carbons. This unique arrangement contributes to its high degree of branching, which influences its physical properties. The compound is typically a colorless liquid at room temperature and exhibits a relatively low boiling point compared to straight-chain alkenes of similar molecular weight. Its branched structure results in lower density and viscosity. 2,2,4,6,6-Pentamethyl-3-heptene is known for its stability and resistance to oxidation, making it useful in various chemical applications, including as a potential intermediate in organic synthesis. Additionally, due to its unsaturation, it can participate in various chemical reactions, such as polymerization and addition reactions. Safety data indicates that, like many organic solvents, it should be handled with care to avoid inhalation or skin contact.
Formula:C12H24
InChI:InChI=1S/C12H24/c1-10(8-11(2,3)4)9-12(5,6)7/h8H,9H2,1-7H3
InChI key:InChIKey=NBUMCEJRJRRLCA-UHFFFAOYSA-N
SMILES:C(=C(C)CC(C)(C)C)C(C)(C)C
- Synonyms:
- 2,2,4,6,6-Pentamethyl-3-heptene
- 3-Heptene, 2,2,4,6,6-pentamethyl-
